Difference between revisions of "PWY-6181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181] ==
* smiles:
+
* taxonomic range:
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
+
 
* common name:
 
* common name:
** betanidin quinone
+
** histamine degradation
* molecular weight:
+
** 384.301   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-8635]]
+
* [[RXN-10089]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_3513]]
 +
*** [[Tiso_gene_7322]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9600]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8756]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HISTAMINE-N-METHYLTRANSFERASE-RXN HISTAMINE-N-METHYLTRANSFERASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-MAP:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
+
** [http://www.genome.jp/dbget-bin/www_bget?map00340 map00340]
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: taxonomic range=TAX-33208}}
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
+
{{#set: common name=histamine degradation}}
{{#set: common name=betanidin quinone}}
+
{{#set: reaction found=2}}
{{#set: molecular weight=384.301    }}
+
{{#set: total reaction=3}}
{{#set: produced by=RXN-8635}}
+
{{#set: completion rate=67.0}}

Latest revision as of 20:43, 21 March 2018

Pathway PWY-6181

  • taxonomic range:
  • common name:
    • histamine degradation
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links