Difference between revisions of "CPD-19203"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dihydro-Lipoyl-Proteins Dihydro-Lipoyl-Proteins] == * common name: ** a [lipoyl-carrier protein...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] == * smiles: ** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dihydro-Lipoyl-Proteins Dihydro-Lipoyl-Proteins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19203 CPD-19203] ==
 +
* smiles:
 +
** C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)
 
* common name:
 
* common name:
** a [lipoyl-carrier protein] N6-dihydrolipoyl-L-lysine
+
** D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
 +
* inchi key:
 +
** InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N
 +
* molecular weight:
 +
** 403.391   
 
* Synonym(s):
 
* Synonym(s):
** an [enzyme] N6-(dihydrolipoyl)lysine
+
** D-pHPG-L-Ser-L-pHPG
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.1.4-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17832]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a [lipoyl-carrier protein] N6-dihydrolipoyl-L-lysine}}
+
{{#set: smiles=C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)}}
{{#set: common name=an [enzyme] N6-(dihydrolipoyl)lysine}}
+
{{#set: common name=D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}}
{{#set: consumed by=1.8.1.4-RXN}}
+
{{#set: inchi key=InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N}}
 +
{{#set: molecular weight=403.391    }}
 +
{{#set: common name=D-pHPG-L-Ser-L-pHPG}}
 +
{{#set: produced by=RXN-17832}}

Latest revision as of 19:43, 21 March 2018

Metabolite CPD-19203

  • smiles:
    • C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)
  • common name:
    • D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
  • inchi key:
    • InChIKey=ZYPJZNYMRGJBEP-XHSDSOJGSA-N
  • molecular weight:
    • 403.391
  • Synonym(s):
    • D-pHPG-L-Ser-L-pHPG

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2)" cannot be used as a page name in this wiki.