Difference between revisions of "CPD-19042"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == * smiles: ** C=CC2(C(C)=C4(C=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19042 CPD-19042] == * smiles: ** CC(O)(C)C(=O)N * common name: ** 2-hydroxyisobutyramide *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19042 CPD-19042] ==
 
* smiles:
 
* smiles:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))
+
** CC(O)(C)C(=O)N
 
* common name:
 
* common name:
−
** 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester
+
** 2-hydroxyisobutyramide
 +
* inchi key:
 +
** InChIKey=DRYMMXUBDRJPDS-UHFFFAOYSA-N
 
* molecular weight:
 
* molecular weight:
−
** 613.974    
+
** 103.121    
 
* Synonym(s):
 
* Synonym(s):
−
** 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-5283]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-5282]]
+
* [[RXN-17609]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-17608]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: smiles=CC(O)(C)C(=O)N}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658233 90658233]
+
{{#set: common name=2-hydroxyisobutyramide}}
−
* HMDB : HMDB02379
+
{{#set: inchi key=InChIKey=DRYMMXUBDRJPDS-UHFFFAOYSA-N}}
−
* CHEBI:
+
{{#set: molecular weight=103.121    }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60489 60489]
+
{{#set: produced by=RXN-17609}}
−
* LIGAND-CPD:
+
{{#set: reversible reaction associated=RXN-17608}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11829 C11829]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))}}
+
−
{{#set: common name=131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=613.974    }}
+
−
{{#set: common name=131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: consumed by=RXN-5283}}
+
−
{{#set: produced by=RXN-5282}}
+

Latest revision as of 20:43, 21 March 2018

Metabolite CPD-19042

  • smiles:
    • CC(O)(C)C(=O)N
  • common name:
    • 2-hydroxyisobutyramide
  • inchi key:
    • InChIKey=DRYMMXUBDRJPDS-UHFFFAOYSA-N
  • molecular weight:
    • 103.121
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-19042&oldid=43457"