Difference between revisions of "L-1-GLYCEROPHOSPHORYLETHANOL-AMINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] == * direction: ** LEFT-TO-RIGHT * common name: ** lanosterol 14-hydroxylase *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * smiles: ** C(OP([O-...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-303 RXN66-303] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])(OCC(CO)O)=O)C[N+]
 
* common name:
 
* common name:
−
** lanosterol 14-hydroxylase
+
** sn-glycero-3-phosphoethanolamine
 +
* inchi key:
 +
** InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N
 +
* molecular weight:
 +
** 215.142   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-1-glycerophosphorylethanolamine
 +
** 1-glycerophosphorylethanolamine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14160]]
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[LANOSTEROL]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-4568]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-15035]]
−
** 1 oxygen[c] '''+''' 1 H+[c] '''+''' 1 lanosterol[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 H2O[c] '''+''' 1 14-hydroxylanosterol[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8263]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
−
** '''8''' reactions found over '''22''' reactions in the full pathway
+
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
−
** '''7''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=lanosterol 14-hydroxylase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01233 C01233]
−
{{#set: gene associated=Tiso_gene_8263}}
+
* HMDB : HMDB00114
−
{{#set: in pathway=PWY66-341|PWY66-4}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16929 16929]
−
{{#set: reconstruction tool=pantograph}}
+
* BIGG : g3pe
−
{{#set: reconstruction source=esiliculosus}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678815 70678815]
 +
{{#set: smiles=C(OP([O-])(OCC(CO)O)=O)C[N+]}}
 +
{{#set: common name=sn-glycero-3-phosphoethanolamine}}
 +
{{#set: inchi key=InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N}}
 +
{{#set: molecular weight=215.142    }}
 +
{{#set: common name=L-1-glycerophosphorylethanolamine|1-glycerophosphorylethanolamine}}
 +
{{#set: consumed by=RXN-14160}}
 +
{{#set: produced by=RXN-15035}}

Latest revision as of 19:43, 21 March 2018

Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE

  • smiles:
    • C(OP([O-])(OCC(CO)O)=O)C[N+]
  • common name:
    • sn-glycero-3-phosphoethanolamine
  • inchi key:
    • InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N
  • molecular weight:
    • 215.142
  • Synonym(s):
    • L-1-glycerophosphorylethanolamine
    • 1-glycerophosphorylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(OCC(CO)O)=O)C[N+" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE&oldid=43459"