Difference between revisions of "PWY-7181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7181 PWY-7181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7181 PWY-7181] ==
* smiles:
+
* taxonomic range:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** chlorophyll a
+
** pyrimidine deoxyribonucleosides degradation
* molecular weight:
+
** 892.495   
+
 
* Synonym(s):
 
* Synonym(s):
** chlorophyll a (phytol)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RME294]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[THYM-PHOSPH-RXN]]
* [[RXN-17428]]
+
** 1 associated gene(s):
* [[R06284]]
+
*** [[Tiso_gene_1011]]
* [[RXN-7666]]
+
** 1 reconstruction source(s) associated:
== Reaction(s) of unknown directionality ==
+
*** [[annotation-in-silico_annotation]]
* [[RXN1F-66]]
+
* [[URA-PHOSPH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_20384]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=CYTIDEAM-RXN CYTIDEAM-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 479-61-8
+
* ECOCYC:
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7181 PWY-7181]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
+
{{#set: taxonomic range=TAX-33208}}
* KNAPSACK : C00001528
+
{{#set: taxonomic range=TAX-2157}}
* HMDB : HMDB38578
+
{{#set: taxonomic range=TAX-2}}
* LIGAND-CPD:
+
{{#set: common name=pyrimidine deoxyribonucleosides degradation}}
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
+
{{#set: reaction found=2}}
* CHEBI:
+
{{#set: total reaction=3}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
+
{{#set: completion rate=67.0}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyll a}}
+
{{#set: molecular weight=892.495    }}
+
{{#set: common name=chlorophyll a (phytol)}}
+
{{#set: consumed by=RME294}}
+
{{#set: produced by=RXN-17428|R06284|RXN-7666}}
+
{{#set: reversible reaction associated=RXN1F-66}}
+

Latest revision as of 19:43, 21 March 2018

Pathway PWY-7181

  • taxonomic range:
  • common name:
    • pyrimidine deoxyribonucleosides degradation
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links