Difference between revisions of "Tiso gene 5561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == * smiles: ** CSCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=GRUGZHAOXOPASC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5561 == * right end position: ** 9220 * transcription direction: ** POSITIVE * left end position: ** 4966 * centisome position: ** 37.59273...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] ==
+
== Gene Tiso_gene_5561 ==
* smiles:
+
* right end position:
** CSCCCCC(=O)C([O-])=O
+
** 9220
* inchi key:
+
* transcription direction:
** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
+
** POSITIVE
* common name:
+
* left end position:
** 6-(methylthio)-2-oxohexanoate
+
** 4966
* molecular weight:
+
* centisome position:
** 175.222    
+
** 37.59273    
 
* Synonym(s):
 
* Synonym(s):
** 6-(methylthio)-2-oxohexanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
* [[RXN-18209]]
+
** Source: [[annotation-in-silico_annotation]]
* [[RXNQT-4165]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=9220}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195]
+
{{#set: transcription direction=POSITIVE}}
* KNAPSACK : C00007648
+
{{#set: left end position=4966}}
{{#set: smiles=CSCCCCC(=O)C([O-])=O}}
+
{{#set: centisome position=37.59273   }}
{{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}}
+
{{#set: reaction associated=TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN}}
{{#set: common name=6-(methylthio)-2-oxohexanoate}}
+
{{#set: molecular weight=175.222   }}
+
{{#set: common name=6-(methylthio)-2-oxohexanoic acid}}
+
{{#set: produced by=RXN-18209|RXNQT-4165}}
+

Latest revision as of 19:44, 21 March 2018

Gene Tiso_gene_5561

  • right end position:
    • 9220
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4966
  • centisome position:
    • 37.59273
  • Synonym(s):

Reactions associated

Pathways associated

External links