Difference between revisions of "CPD-13559"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14278 RXN-14278] == * direction: ** REVERSIBLE * common name: ** hexanoyl-CoA dehydrogenase **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * common name: ** α-D-man...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14278 RXN-14278] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(O)C1(C(O)C(O)C(O)C(O)O1)
 
* common name:
 
* common name:
−
** hexanoyl-CoA dehydrogenase
+
** α-D-mannopyranose
−
** acyl-_dehydrogenase
+
* inchi key:
−
** acyl-coenzyme_a_oxidase
+
** InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N
−
** ORF
+
* molecular weight:
−
** acyl-CoA_dehydrogenase
+
** 180.157   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.3.8.7 EC-1.3.8.7]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[HEXANOYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''<=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD0-2121]][c]
+
* [[3.2.1.24-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 hexanoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''<=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 trans-hex-2-enoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_6475]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_14511]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_883]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_17967]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_16631]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_18566]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_5991]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_8272]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31208 31208]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=185698 185698]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04751 R04751]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28729 28729]
−
{{#set: direction=REVERSIBLE}}
+
* METABOLIGHTS : MTBLC28729
−
{{#set: common name=hexanoyl-CoA dehydrogenase}}
+
* LIGAND-CPD:
−
{{#set: common name=acyl-_dehydrogenase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00936 C00936]
−
{{#set: common name=acyl-coenzyme_a_oxidase}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O)O1)}}
−
{{#set: common name=ORF}}
+
{{#set: common name=&alpha;-D-mannopyranose}}
−
{{#set: common name=acyl-CoA_dehydrogenase}}
+
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N}}
−
{{#set: ec number=EC-1.3.8.7}}
+
{{#set: molecular weight=180.157    }}
−
{{#set: gene associated=Tiso_gene_6475|Tiso_gene_14511|Tiso_gene_883|Tiso_gene_17967|Tiso_gene_16631|Tiso_gene_18566|Tiso_gene_5991|Tiso_gene_8272}}
+
{{#set: produced by=3.2.1.24-RXN}}
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 20:44, 21 March 2018

Metabolite CPD-13559

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O)O1)
  • common name:
    • α-D-mannopyranose
  • inchi key:
    • InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N
  • molecular weight:
    • 180.157
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13559&oldid=43498"