Difference between revisions of "Tiso gene 20110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_20110 == * right end position: ** 1719 * transcription direction: ** POSITIVE * left end position: ** 502 * centisome position: ** 28.66933...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_20110 == |
− | * | + | * right end position: |
− | ** | + | ** 1719 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 502 |
− | * | + | * centisome position: |
− | ** | + | ** 28.66933 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[GSHTRAN-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[RXN- | + | *** Assignment: ec-number |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[GST-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13673]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-15680]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7112]] | ||
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1719}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=502}} | |
− | + | {{#set: centisome position=28.66933 }} | |
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:44, 21 March 2018
Gene Tiso_gene_20110
- right end position:
- 1719
- transcription direction:
- POSITIVE
- left end position:
- 502
- centisome position:
- 28.66933
- Synonym(s):
Reactions associated
- Reaction: GSHTRAN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: GST-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-13673
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-15680
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation