Difference between revisions of "Tiso gene 20110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Tiso_gene_20110 == * right end position: ** 1719 * transcription direction: ** POSITIVE * left end position: ** 502 * centisome position: ** 28.66933...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] ==
+
== Gene Tiso_gene_20110 ==
−
* smiles:
+
* right end position:
−
** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
+
** 1719
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** leucodopachrome
+
** 502
−
* molecular weight:
+
* centisome position:
−
** 194.166    
+
** 28.66933    
 
* Synonym(s):
 
* Synonym(s):
−
** cyclo-dopa
 
−
** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11369]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-8483]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1719}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=502}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604]
+
{{#set: centisome position=28.66933   }}
−
* HMDB : HMDB04067
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
{{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}}
+
−
{{#set: common name=leucodopachrome}}
+
−
{{#set: molecular weight=194.166   }}
+
−
{{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}}
+
−
{{#set: consumed by=RXN-11369}}
+
−
{{#set: produced by=RXN-8483}}
+

Latest revision as of 19:44, 21 March 2018

Gene Tiso_gene_20110

  • right end position:
    • 1719
  • transcription direction:
    • POSITIVE
  • left end position:
    • 502
  • centisome position:
    • 28.66933
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_20110&oldid=43500"