Difference between revisions of "CPD-8890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11281 PWY3DJ-11281] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** sphingomyelin metabolism
+
** betanidin quinone
 +
* inchi key:
 +
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
 +
* molecular weight:
 +
** 384.301   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-12339]]
+
* [[RXN-8635]]
* [[RXN-15211]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-15212]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
{{#set: common name=sphingomyelin metabolism}}
+
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
{{#set: reaction found=3}}
+
{{#set: common name=betanidin quinone}}
{{#set: reaction not found=3}}
+
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
{{#set: completion rate=100.0}}
+
{{#set: molecular weight=384.301    }}
 +
{{#set: produced by=RXN-8635}}

Latest revision as of 19:44, 21 March 2018

Metabolite CPD-8890

  • smiles:
    • C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
  • common name:
    • betanidin quinone
  • inchi key:
    • InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
  • molecular weight:
    • 384.301
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.