Difference between revisions of "CPD-8890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_19661 == * Synonym(s): == Reactions associated == * Reaction: GLUTAMIN-RXN ** Source: orthology-esiliculosus == Pathways associate...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_19661 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
 +
* smiles:
 +
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
 +
* common name:
 +
** betanidin quinone
 +
* inchi key:
 +
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
 +
* molecular weight:
 +
** 384.301   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[GLUTAMIN-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[orthology-esiliculosus]]
+
* [[RXN-8635]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[GLUTAMINDEG-PWY]]
+
* [[CITRULBIO-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GLUTAMIN-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=GLUTAMINDEG-PWY|CITRULBIO-PWY}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
 +
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
 +
{{#set: common name=betanidin quinone}}
 +
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
 +
{{#set: molecular weight=384.301    }}
 +
{{#set: produced by=RXN-8635}}

Latest revision as of 20:44, 21 March 2018

Metabolite CPD-8890

  • smiles:
    • C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
  • common name:
    • betanidin quinone
  • inchi key:
    • InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
  • molecular weight:
    • 384.301
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.