Difference between revisions of "PWY-7579"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579] ==
* smiles:
+
* taxonomic range:
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
* inchi key:
+
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
+
 
* common name:
 
* common name:
** betanidin quinone
+
** phycourobilin biosynthesis
* molecular weight:
+
** 384.301   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''5''' reactions in the full pathway
* [[RXN-8635]]
+
* [[1.3.7.3-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_17350]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.2-RXN 1.3.7.2-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15985 RXN-15985]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15990 RXN-15990]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17523 RXN-17523]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1117}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
+
{{#set: common name=phycourobilin biosynthesis}}
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
+
{{#set: total reaction=5}}
{{#set: common name=betanidin quinone}}
+
{{#set: completion rate=20.0}}
{{#set: molecular weight=384.301    }}
+
{{#set: produced by=RXN-8635}}
+

Latest revision as of 19:44, 21 March 2018

Pathway PWY-7579

  • taxonomic range:
  • common name:
    • phycourobilin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links