Difference between revisions of "CPD-18118"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11614 == * Synonym(s): == Reactions associated == * MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN ** pantograph-athaliana ** pantog...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** D-...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == |
+ | * smiles: | ||
+ | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) | ||
+ | * common name: | ||
+ | ** D-arabinofuranose 5-phosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L | ||
+ | * molecular weight: | ||
+ | ** 228.095 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-arabinofuranose 5P | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[KDO-8PSYNTH-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971] | ||
+ | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} | ||
+ | {{#set: common name=D-arabinofuranose 5-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}} | ||
+ | {{#set: molecular weight=228.095 }} | ||
+ | {{#set: common name=D-arabinofuranose 5P}} | ||
+ | {{#set: consumed by=KDO-8PSYNTH-RXN}} |
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite CPD-18118
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
- common name:
- D-arabinofuranose 5-phosphate
- inchi key:
- InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
- molecular weight:
- 228.095
- Synonym(s):
- D-arabinofuranose 5P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.