Difference between revisions of "RXN-9600"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N) * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9600 RXN-9600] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9600 RXN-9600] ==
* smiles:
+
* direction:
** C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N
+
** [http://enzyme.expasy.org/EC/1.4.3.22 EC-1.4.3.22]
* common name:
+
** taxiphyllin
+
* molecular weight:
+
** 311.291   
+
 
* Synonym(s):
 
* Synonym(s):
** (R)-4-hydroxymandelonitrile β-D-glucoside
 
** (2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile
 
** (R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13600]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[HISTAMINE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[IMIDAZOLE_ACETALDEHYDE]][c] '''+''' 1 [[AMMONIUM]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 oxygen[c] '''+''' 1 histamine[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 imidazole acetaldehyde[c] '''+''' 1 ammonium[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8756]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[PWY-6181]], histamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 21401-21-8
+
* RHEA:
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25628 25628]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107721 107721]
+
* LIGAND-RXN:
* HMDB : HMDB30704
+
** [http://www.genome.jp/dbget-bin/www_bget?R02150 R02150]
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C01855 C01855]
+
{{#set: ec number=EC-1.4.3.22}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_8756}}
** [http://www.chemspider.com/Chemical-Structure.96890.html 96890]
+
{{#set: in pathway=PWY-6181}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16267 16267]
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: smiles=C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N)}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N}}
+
{{#set: common name=taxiphyllin}}
+
{{#set: molecular weight=311.291    }}
+
{{#set: common name=(R)-4-hydroxymandelonitrile β-D-glucoside|(2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile|(R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile}}
+
{{#set: consumed by=RXN-13600}}
+

Latest revision as of 19:44, 21 March 2018

Reaction RXN-9600

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6181, histamine degradation: PWY-6181
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links