Difference between revisions of "Alkylated-Bases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkylated-Bases Alkylated-Bases] == * common name: ** an alkylated nucleobase * Synonym(s): **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alkylated-Bases Alkylated-Bases] ==
* smiles:
+
** CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)
+
* inchi key:
+
** InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J
+
 
* common name:
 
* common name:
** α-linolenoyl-CoA
+
** an alkylated nucleobase
* molecular weight:
+
** 1023.921   
+
 
* Synonym(s):
 
* Synonym(s):
** 18:3Δ9,12,15
+
** an alkylated nucleotide base
** (9Z,12Z,15Z)-octadecatrienoyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FACOAE1839Z12Z15Z]]
 
* [[RXN-13441]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LINOLENOYL-RXN]]
+
* [[3.2.2.21-RXN]]
* [[LNLNCACOAL]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an alkylated nucleobase}}
** [http://www.genome.jp/dbget-bin/www_bget?C16162 C16162]
+
{{#set: common name=an alkylated nucleotide base}}
* CHEBI:
+
{{#set: produced by=3.2.2.21-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=51985 51985]
+
* METABOLIGHTS : MTBLC51985
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859601 49859601]
+
* HMDB : HMDB06290
+
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)}}
+
{{#set: inchi key=InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J}}
+
{{#set: common name=α-linolenoyl-CoA}}
+
{{#set: molecular weight=1023.921    }}
+
{{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA}}
+
{{#set: consumed by=FACOAE1839Z12Z15Z|RXN-13441}}
+
{{#set: produced by=LINOLENOYL-RXN|LNLNCACOAL}}
+

Latest revision as of 19:44, 21 March 2018

Metabolite Alkylated-Bases

  • common name:
    • an alkylated nucleobase
  • Synonym(s):
    • an alkylated nucleotide base

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links