Difference between revisions of "CPD-13912"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.11-RXN 6.3.4.11-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * common name: ** 2-c...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.11-RXN 6.3.4.11-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/6.3.4.11 EC-6.3.4.11]
+
** 2-carboxy-L-threo-pentonate
 +
* inchi key:
 +
** InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 208.124   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-carboxy-L-xylonate
 +
** 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Apo-3-methylcrotonoyl-CoA-carbon-dioxide]][c] '''+''' 1 [[BIOTIN]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[3-methylcrotonoyl-CoA-carbon-dioxide]][c]
+
* [[RXN-12871]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an apo-[3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming)][c] '''+''' 1 biotin[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 a holo-[3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming)][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8713]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_17216]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04604 R04604]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657336 90657336]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O}}
−
{{#set: ec number=EC-6.3.4.11}}
+
{{#set: common name=2-carboxy-L-threo-pentonate}}
−
{{#set: gene associated=Tiso_gene_8713|Tiso_gene_17216}}
+
{{#set: inchi key=InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=208.124    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=2-carboxy-L-xylonate|2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-12871}}
−
{{#set: reconstruction source=esiliculosus}}
+

Latest revision as of 19:44, 21 March 2018

Metabolite CPD-13912

  • smiles:
    • C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
  • common name:
    • 2-carboxy-L-threo-pentonate
  • inchi key:
    • InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
  • molecular weight:
    • 208.124
  • Synonym(s):
    • 2-carboxy-L-xylonate
    • 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13912&oldid=43571"