Difference between revisions of "LINOLENOYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6299 == * left end position: ** 1959 * transcription direction: ** POSITIVE * right end position: ** 3976 * centisome position: ** 15.87134...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3) |
− | * | + | * common name: |
− | ** | + | ** α-linolenoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 1023.921 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 18:3Δ9,12,15 | ||
+ | ** (9Z,12Z,15Z)-octadecatrienoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[FACOAE1839Z12Z15Z]] |
− | * | + | * [[RXN-13441]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[LINOLENOYL-RXN]] |
+ | * [[LNLNCACOAL]] | ||
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16162 C16162] |
− | {{#set: | + | * HMDB : HMDB06290 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=51985 51985] |
+ | * METABOLIGHTS : MTBLC51985 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859601 49859601] | ||
+ | {{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)}} | ||
+ | {{#set: common name=α-linolenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J}} | ||
+ | {{#set: molecular weight=1023.921 }} | ||
+ | {{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA}} | ||
+ | {{#set: consumed by=FACOAE1839Z12Z15Z|RXN-13441}} | ||
+ | {{#set: produced by=LINOLENOYL-RXN|LNLNCACOAL}} |
Latest revision as of 20:45, 21 March 2018
Contents
Metabolite LINOLENOYL-COA
- smiles:
- CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)
- common name:
- α-linolenoyl-CoA
- inchi key:
- InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J
- molecular weight:
- 1023.921
- Synonym(s):
- 18:3Δ9,12,15
- (9Z,12Z,15Z)-octadecatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)" cannot be used as a page name in this wiki.