Difference between revisions of "Tiso gene 19932"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_19932 == * Synonym(s): == Reactions associated == * Reaction: DIOHBUTANONEPSYN-RXN ** Source: orthology-esiliculosus * Reaction: [...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19932 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DIOHBUTANONEPSYN-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * | + | * Reaction: [[GTP-CYCLOHYDRO-II-RXN]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | == Pathways associated == | |
− | + | * [[PWY-7539]] | |
− | + | * [[PWY-6167]] | |
− | * | + | * [[PWY-6168]] |
− | * [[ | + | * [[RIBOSYN2-PWY]] |
− | * | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=DIOHBUTANONEPSYN-RXN|GTP-CYCLOHYDRO-II-RXN}} | |
− | + | {{#set: pathway associated=PWY-7539|PWY-6167|PWY-6168|RIBOSYN2-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:45, 21 March 2018
Gene Tiso_gene_19932
- Synonym(s):
Reactions associated
- Reaction: DIOHBUTANONEPSYN-RXN
- Source: orthology-esiliculosus
- Reaction: GTP-CYCLOHYDRO-II-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus