Difference between revisions of "CPD-14405"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4806 == * left end position: ** 10343 * transcription direction: ** POSITIVE * right end position: ** 11452 * centisome position: ** 39.594...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14405 CPD-14405] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14405 CPD-14405] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** 3R-hydroxy-dihomo γ-linolenoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=GFVFSXUAKLZOGC-NULWUIHISA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 1067.974 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (8Z,11Z,14Z)-3R-hydroxy-icosa-8,11,14-trienoyl-CoA | ||
+ | ** (8Z,11Z,14Z)-3R-hydroxy-icosatrienoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12968]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551500 72551500] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76411 76411] |
− | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: common name=3R-hydroxy-dihomo γ-linolenoyl-CoA}} |
+ | {{#set: inchi key=InChIKey=GFVFSXUAKLZOGC-NULWUIHISA-J}} | ||
+ | {{#set: molecular weight=1067.974 }} | ||
+ | {{#set: common name=(8Z,11Z,14Z)-3R-hydroxy-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-3R-hydroxy-icosatrienoyl-CoA}} | ||
+ | {{#set: produced by=RXN-12968}} |
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite CPD-14405
- smiles:
- CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3R-hydroxy-dihomo γ-linolenoyl-CoA
- inchi key:
- InChIKey=GFVFSXUAKLZOGC-NULWUIHISA-J
- molecular weight:
- 1067.974
- Synonym(s):
- (8Z,11Z,14Z)-3R-hydroxy-icosa-8,11,14-trienoyl-CoA
- (8Z,11Z,14Z)-3R-hydroxy-icosatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.