Difference between revisions of "PWY-5509"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''8''' reactions in the full pathway |
− | * [[ | + | * [[R344-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_6190]] |
− | == | + | ** 1 reconstruction source(s) associated: |
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-8770]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_16271]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R343-RXN R343-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R345-RXN R345-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=8}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:46, 21 March 2018
Pathway PWY-5509
- taxonomic range:
- common name:
- adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I
- Synonym(s):
Reaction(s) found
2 reactions found over 8 reactions in the full pathway
- R344-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8770
- 1 associated gene(s):
- 1 reconstruction source(s) associated: