Difference between revisions of "PWY-5973"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973] ==
−
* smiles:
+
* taxonomic range:
−
** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
−
** InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J
+
 
* common name:
 
* common name:
−
** icosatrienoyl-2-enoyl CoA
+
** cis-vaccenate biosynthesis
−
* molecular weight:
+
−
** 1049.959   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 18:3Δ9,12,15
+
** cis vaccenic acid acid biosynthesis
−
** (9Z,12Z,15Z)-octadecatrienoyl-CoA
+
−
** eicosatrienoyl-2-enoyl CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-12997]]
+
'''4''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.3.1.179-RXN]]
−
* [[RXN-13001]]
+
** 3 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_19303]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9556]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_9885]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9557]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6884]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-9558]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_10778]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9555 RXN-9555]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551551 72551551]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5973 PWY-5973]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76456 76456]
+
{{#set: taxonomic range=TAX-3398}}
−
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=cis-vaccenate biosynthesis}}
−
{{#set: inchi key=InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J}}
+
{{#set: common name=cis vaccenic acid acid biosynthesis}}
−
{{#set: common name=icosatrienoyl-2-enoyl CoA}}
+
{{#set: reaction found=4}}
−
{{#set: molecular weight=1049.959    }}
+
{{#set: total reaction=5}}
−
{{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA|eicosatrienoyl-2-enoyl CoA}}
+
{{#set: completion rate=80.0}}
−
{{#set: consumed by=RXN-12997}}
+
−
{{#set: produced by=RXN-13001}}
+

Latest revision as of 19:46, 21 March 2018

Pathway PWY-5973

  • taxonomic range:
  • common name:
    • cis-vaccenate biosynthesis
  • Synonym(s):
    • cis vaccenic acid acid biosynthesis

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5973&oldid=43690"