Difference between revisions of "PWY-5870"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5870 PWY-5870] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4890 TAX-48...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5870 PWY-5870] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4890 TAX-4890] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ubiquinol-8 biosynthesis (eukaryotic) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ubiquinone-8 biosynthesis (eukaryotic) |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''9''' reactions in the full pathway |
− | == Reaction(s) | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_19352]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_4719]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[DHHB-METHYLTRANSFER-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_6943]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-METHOXYPHENOL-HYDROX-RXN 2-OCTAPRENYL-6-METHOXYPHENOL-HYDROX-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=CHORPYRLY-RXN CHORPYRLY-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-METHOXY-BENZOQ-OH-RXN OCTAPRENYL-METHYL-METHOXY-BENZOQ-OH-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9277 RXN-9277] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9280 RXN-9280] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9283 RXN-9283] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4890}} | |
− | + | {{#set: common name=ubiquinol-8 biosynthesis (eukaryotic)}} | |
− | + | {{#set: common name=ubiquinone-8 biosynthesis (eukaryotic)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:46, 21 March 2018
Pathway PWY-5870
- taxonomic range:
- common name:
- ubiquinol-8 biosynthesis (eukaryotic)
- Synonym(s):
- ubiquinone-8 biosynthesis (eukaryotic)
Reaction(s) found
3 reactions found over 9 reactions in the full pathway
- 2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- 4OHBENZOATE-OCTAPRENYLTRANSFER-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- DHHB-METHYLTRANSFER-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- 2-OCTAPRENYL-6-METHOXYPHENOL-HYDROX-RXN
- CHORPYRLY-RXN
- OCTAPRENYL-METHYL-METHOXY-BENZOQ-OH-RXN
- RXN-9277
- RXN-9280
- RXN-9283