Difference between revisions of "RXN-10642"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10642 RXN-10642] == * direction: ** REVERSIBLE * common name: ** uroporphyrinogen_chloroplast *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10642 RXN-10642] ==
−
* smiles:
+
* direction:
−
** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K
+
 
* common name:
 
* common name:
−
** D-gluconate 6-phosphate
+
** uroporphyrinogen_chloroplast
−
* molecular weight:
+
** uroporphyrinogen_decarboxylase
−
** 273.113   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.1.1.37 EC-4.1.1.37]
 
* Synonym(s):
 
* Synonym(s):
−
** 6-p gluconate
 
−
** 6-phospho gluconate
 
−
** 6-phosphogluconic acid
 
−
** 6-phospho D-gluconate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9952]]
+
* With identifiers:
−
* [[6PGLUCONDEHYDROG-RXN]]
+
** 1 [[CPD-11444]][c] '''+''' 4 [[PROTON]][c] '''<=>''' 4 [[CARBON-DIOXIDE]][c] '''+''' 1 [[COPROPORPHYRINOGEN_I]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[6PGLUCONOLACT-RXN]]
+
** 1 uroporphyrinogen-I[c] '''+''' 4 H+[c] '''<=>''' 4 CO2[c] '''+''' 1 coproporphyrinogen I[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5173]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_18744]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18743]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19684]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 6pgc
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31239 31239]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688186 36688186]
+
* LIGAND-RXN:
−
* HMDB : HMDB01316
+
** [http://www.genome.jp/dbget-bin/www_bget?R04972 R04972]
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00345 C00345]
+
{{#set: common name=uroporphyrinogen_chloroplast}}
−
* CHEBI:
+
{{#set: common name=uroporphyrinogen_decarboxylase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58759 58759]
+
{{#set: ec number=EC-4.1.1.37}}
−
* METABOLIGHTS : MTBLC58759
+
{{#set: gene associated=Tiso_gene_5173|Tiso_gene_18744|Tiso_gene_18743|Tiso_gene_19684}}
−
{{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=D-gluconate 6-phosphate}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-creinhardtii|orthology-esiliculosus}}
−
{{#set: molecular weight=273.113    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=6-p gluconate|6-phospho gluconate|6-phosphogluconic acid|6-phospho D-gluconate}}
+
−
{{#set: consumed by=RXN-9952|6PGLUCONDEHYDROG-RXN}}
+
−
{{#set: produced by=6PGLUCONOLACT-RXN}}
+

Latest revision as of 20:47, 21 March 2018

Reaction RXN-10642

  • direction:
    • REVERSIBLE
  • common name:
    • uroporphyrinogen_chloroplast
    • uroporphyrinogen_decarboxylase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10642&oldid=43725"