Difference between revisions of "CPD-474"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * c...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
 
* common name:
 
* common name:
−
** adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I
+
** (+)-taxifolin
 +
* inchi key:
 +
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
 +
* molecular weight:
 +
** 303.248   
 
* Synonym(s):
 
* Synonym(s):
 +
** trans dihydroquercetin
 +
** (+)-dihydroquercetin
 +
** taxifolin
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-527]]
−
* [[R344-RXN]]
+
* [[RXN-600]]
−
** 1 associated gene(s):
+
== Reaction(s) known to produce the compound ==
−
*** [[Tiso_gene_6190]]
+
* [[RXN-7775]]
−
** 1 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-8770]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_16271]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=R343-RXN R343-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=R345-RXN R345-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* CAS : 480-18-2
−
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
−
{{#set: common name=adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891]
−
{{#set: reaction found=2}}
+
* CHEBI:
−
{{#set: total reaction=8}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329]
−
{{#set: completion rate=25.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617]
 +
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}}
 +
{{#set: common name=(+)-taxifolin}}
 +
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}}
 +
{{#set: molecular weight=303.248    }}
 +
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}}
 +
{{#set: consumed by=RXN-527|RXN-600}}
 +
{{#set: produced by=RXN-7775}}

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-474

  • smiles:
    • C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
  • common name:
    • (+)-taxifolin
  • inchi key:
    • InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
  • molecular weight:
    • 303.248
  • Synonym(s):
    • trans dihydroquercetin
    • (+)-dihydroquercetin
    • taxifolin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-474&oldid=43735"