Difference between revisions of "CPD-474"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-uracil1498 16S-rRNA-uracil1498] == * common name: ** a uracil1498 in 16S rRNA * Synony...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * c...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-uracil1498 16S-rRNA-uracil1498] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
 +
* smiles:
 +
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
 
* common name:
 
* common name:
** a uracil1498 in 16S rRNA
+
** (+)-taxifolin
 +
* inchi key:
 +
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
 +
* molecular weight:
 +
** 303.248   
 
* Synonym(s):
 
* Synonym(s):
 +
** trans dihydroquercetin
 +
** (+)-dihydroquercetin
 +
** taxifolin
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11598]]
+
* [[RXN-527]]
 +
* [[RXN-600]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7775]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a uracil1498 in 16S rRNA}}
+
* CAS : 480-18-2
{{#set: consumed by=RXN-11598}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617]
 +
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}}
 +
{{#set: common name=(+)-taxifolin}}
 +
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}}
 +
{{#set: molecular weight=303.248    }}
 +
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}}
 +
{{#set: consumed by=RXN-527|RXN-600}}
 +
{{#set: produced by=RXN-7775}}

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-474

  • smiles:
    • C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
  • common name:
    • (+)-taxifolin
  • inchi key:
    • InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
  • molecular weight:
    • 303.248
  • Synonym(s):
    • trans dihydroquercetin
    • (+)-dihydroquercetin
    • taxifolin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.