|
|
(3 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCCCOASYN-RXN SUCCCOASYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4) |
| * common name: | | * common name: |
− | ** succinyl-_ligase | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/6.2.1.5 EC-6.2.1.5] | + | ** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J |
| + | * molecular weight: |
| + | ** 1039.92 |
| * Synonym(s): | | * Synonym(s): |
− | ** Succinate thiokinase | + | ** oxopentenyl-cyclopentane-octanoyl-CoA |
− | ** succinyl CoA synthesis | + | ** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA |
| + | ** OPC-8:0-CoA |
| + | ** OPC8-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-10696]] |
− | ** 1 [[CO-A]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[SUC-COA]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-10695]] |
− | ** 1 coenzyme A[c] '''+''' 1 succinate[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 phosphate[c] '''+''' 1 succinyl-CoA[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_11866]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | * [[Tiso_gene_15846]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[P42-PWY]], incomplete reductive TCA cycle: [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY]
| + | |
− | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7384]], anaerobic energy metabolism (invertebrates, mitochondrial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384]
| + | |
− | ** '''7''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-5392]], reductive TCA cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392] | + | |
− | ** '''5''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
| + | |
− | ** '''7''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| + | |
− | ** '''9''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-5537]], pyruvate fermentation to acetate V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
| + | |
− | ** '''11''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-5538]], pyruvate fermentation to acetate VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5538 PWY-5538]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[creinhardtii]]
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[athaliana]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17661 17661] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00405 R00405]
| + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}} |
− | * UNIPROT:
| + | {{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}} |
− | ** [http://www.uniprot.org/uniprot/O28098 O28098]
| + | {{#set: molecular weight=1039.92 }} |
− | ** [http://www.uniprot.org/uniprot/P53594 P53594]
| + | {{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}} |
− | ** [http://www.uniprot.org/uniprot/O28733 O28733]
| + | {{#set: consumed by=RXN-10696}} |
− | ** [http://www.uniprot.org/uniprot/P45101 P45101]
| + | {{#set: produced by=RXN-10695}} |
− | ** [http://www.uniprot.org/uniprot/P45102 P45102]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUT0 Q9JUT0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58643 Q58643]
| + | |
− | ** [http://www.uniprot.org/uniprot/O26663 O26663]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80886 P80886]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHY1 Q9PHY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUS9 Q9JUS9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80865 P80865]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHY0 Q9PHY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67729 O67729]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67546 O67546]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53593 P53593]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AGE9 P0AGE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A836 P0A836]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82662 O82662]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=succinyl-_ligase}} | + | |
− | {{#set: ec number=EC-6.2.1.5}}
| + | |
− | {{#set: common name=Succinate thiokinase|succinyl CoA synthesis}} | + | |
− | {{#set: gene associated=Tiso_gene_11866|Tiso_gene_15846}} | + | |
− | {{#set: in pathway=PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|PWY-6969|PWY-5537|PWY-6728|PWY-5538|PWY-5690|PWY66-398|TCA}} | + | |
− | {{#set: reconstruction category=orthology}}
| + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=creinhardtii|synechocystis|athaliana|esiliculosus}}
| + | |
− | {{#set: reconstruction category=manual}} | + | |
− | {{#set: reconstruction source=primary_network}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |