Difference between revisions of "PWY-561"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** superpathway of glyoxylate cycle and fatty acid degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''5''' reactions found over '''8''' reactions in the full pathway |
− | + | * [[FUMHYDR-RXN]] | |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_3691]] | ||
+ | *** [[Tiso_gene_6720]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[GLYOXYLATE-BYPASS]] | ||
+ | ** 0 associated gene: | ||
+ | * [[MALATE-DEH-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_2323]] | ||
+ | *** [[Tiso_gene_1990]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[PEPCARBOXYKIN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_19475]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[PWY-5136]] | ||
+ | ** 0 associated gene: | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971] | ||
== External links == | == External links == | ||
− | * | + | * METACYC: |
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=PWY-561 PWY-561] |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=superpathway of glyoxylate cycle and fatty acid degradation}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=8}} | |
− | + | {{#set: completion rate=63.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:47, 21 March 2018
Pathway PWY-561
- taxonomic range:
- common name:
- superpathway of glyoxylate cycle and fatty acid degradation
- Synonym(s):
Reaction(s) found
5 reactions found over 8 reactions in the full pathway
- FUMHYDR-RXN
- 2 associated gene(s):
- 6 reconstruction source(s) associated:
- GLYOXYLATE-BYPASS
- 0 associated gene:
- MALATE-DEH-RXN
- 2 associated gene(s):
- 7 reconstruction source(s) associated:
- PEPCARBOXYKIN-RXN
- 1 associated gene(s):
- 5 reconstruction source(s) associated:
- PWY-5136
- 0 associated gene:
Reaction(s) not found
External links
- METACYC: