Difference between revisions of "CPD-13171"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8531 == * Synonym(s): == Reactions associated == * RXN-8999 ** pantograph-athaliana ** pantograph-synechocystis ** p...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == * smiles: ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13171 CPD-13171] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C | ||
| + | * inchi key: | ||
| + | ** InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N | ||
| + | * common name: | ||
| + | ** 15,9'-di-cis-phytofluene | ||
| + | * molecular weight: | ||
| + | ** 542.93 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-12244]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12243]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19765 C19765] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61990 61990] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351778 51351778] | ||
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N}} | ||
| + | {{#set: common name=15,9'-di-cis-phytofluene}} | ||
| + | {{#set: molecular weight=542.93 }} | ||
| + | {{#set: consumed by=RXN-12244}} | ||
| + | {{#set: produced by=RXN-12243}} | ||
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-13171
- smiles:
- CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=OVSVTCFNLSGAMM-IQEMYQFOSA-N
- common name:
- 15,9'-di-cis-phytofluene
- molecular weight:
- 542.93
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
