Difference between revisions of "Tiso gene 2068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)...")
(Created page with "Category:Gene == Gene Tiso_gene_2068 == * right end position: ** 3029 * transcription direction: ** POSITIVE * left end position: ** 1 * centisome position: ** 4.829518200...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] ==
+
== Gene Tiso_gene_2068 ==
−
* smiles:
+
* right end position:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O
+
** 3029
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** maltotriose
+
** 1
−
* molecular weight:
+
* centisome position:
−
** 504.441   
+
** 4.829518200e-3
 
* Synonym(s):
 
* Synonym(s):
−
** amylotriose
 
−
** α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-5183]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN0-5182]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1109-28-0
+
{{#set: right end position=3029}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439586 439586]
+
{{#set: left end position=1}}
−
* HMDB : HMDB01262
+
{{#set: centisome position=4.829518200e-3}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01835 C01835]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.388669.html 388669]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61993 61993]
+
−
* BIGG : malttr
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O}}
+
−
{{#set: inchi key=InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N}}
+
−
{{#set: common name=maltotriose}}
+
−
{{#set: molecular weight=504.441    }}
+
−
{{#set: common name=amylotriose|α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucose}}
+
−
{{#set: consumed by=RXN0-5183}}
+
−
{{#set: produced by=RXN0-5182}}
+

Latest revision as of 19:47, 21 March 2018

Gene Tiso_gene_2068

  • right end position:
    • 3029
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1
  • centisome position:
    • 4.829518200e-3
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2068&oldid=43779"