Difference between revisions of "NAGLIPASYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * in...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NAGLIPASYN-PWY NAGLIPASYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=NAGLIPASYN-PWY NAGLIPASYN-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N
+
 
* common name:
 
* common name:
−
** (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
+
** lipid IVA biosynthesis
−
* molecular weight:
+
−
** 382.542   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** lipid-A-precursor biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''6''' reactions in the full pathway
−
* [[RXN-7974]]
+
* [[LIPIDADISACCHARIDESYNTH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_6736]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[TETRAACYLDISACC4KIN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_8779]]
 +
*** [[Tiso_gene_8780]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[UDPACYLGLCNACDEACETYL-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_19583]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2638]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[UDPNACETYLGLUCOSAMACYLTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_19198]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=LIPIDXSYNTHESIS-RXN LIPIDXSYNTHESIS-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246021 25246021]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=NAGLIPASYN-PWY NAGLIPASYN-PWY]
−
{{#set: smiles=CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: inchi key=InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=(3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}}
+
{{#set: common name=lipid IVA biosynthesis}}
−
{{#set: molecular weight=382.542    }}
+
{{#set: common name=lipid-A-precursor biosynthesis}}
−
{{#set: produced by=RXN-7974}}
+
{{#set: reaction found=5}}
 +
{{#set: total reaction=6}}
 +
{{#set: completion rate=83.0}}

Latest revision as of 19:47, 21 March 2018

Pathway NAGLIPASYN-PWY

  • taxonomic range:
  • common name:
    • lipid IVA biosynthesis
  • Synonym(s):
    • lipid-A-precursor biosynthesis

Reaction(s) found

5 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=NAGLIPASYN-PWY&oldid=43788"