Difference between revisions of "Tiso gene 16529"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...")
(Created page with "Category:Gene == Gene Tiso_gene_16529 == * right end position: ** 1809 * transcription direction: ** POSITIVE * left end position: ** 586 * centisome position: ** 13.63107...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] ==
+
== Gene Tiso_gene_16529 ==
−
* smiles:
+
* right end position:
−
** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O
+
** 1809
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** D-gluconate 6-phosphate
+
** 586
−
* molecular weight:
+
* centisome position:
−
** 273.113    
+
** 13.631077    
 
* Synonym(s):
 
* Synonym(s):
−
** 6-p gluconate
 
−
** 6-phospho gluconate
 
−
** 6-phosphogluconic acid
 
−
** 6-phospho D-gluconate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9952]]
+
* Reaction: [[ATCD]]
−
* [[6PGLUCONDEHYDROG-RXN]]
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATCDm]]
−
* [[6PGLUCONOLACT-RXN]]
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ATDCD]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATDCDm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATDGD]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATDTD]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATDTDm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATDUD]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATDUDm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATGD]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATID]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATIDm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATUD]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ATUDm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[CDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[DADPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[DCDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[DGDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[DTDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[DUDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[GDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[NDPK]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[NDPKm]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14120]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14228]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[UDPKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-7176]]
 +
* [[PWY-7220]]
 +
* [[PWY-7184]]
 +
* [[PWY-7222]]
 +
* [[PWY-7205]]
 +
* [[PWY-7224]]
 +
* [[PWY-7197]]
 +
* [[PWY0-166]]
 +
* [[PWY-7227]]
 +
* [[PPGPPMET-PWY]]
 +
* [[PWY-7226]]
 +
* [[PWY-7221]]
 +
* [[PWY-6545]]
 +
* [[PWY-7187]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 6pgc
+
{{#set: right end position=1809}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688186 36688186]
+
{{#set: left end position=586}}
−
* HMDB : HMDB01316
+
{{#set: centisome position=13.631077   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATCD|ATCDm|ATDCD|ATDCDm|ATDGD|ATDTD|ATDTDm|ATDUD|ATDUDm|ATGD|ATID|ATIDm|ATUD|ATUDm|CDPKIN-RXN|DADPKIN-RXN|DCDPKIN-RXN|DGDPKIN-RXN|DTDPKIN-RXN|DUDPKIN-RXN|GDPKIN-RXN|NDPK|NDPKm|NUCLEOSIDE-DIP-KIN-RXN|RXN-14120|RXN-14228|UDPKIN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00345 C00345]
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7176|PWY-7220|PWY-7184|PWY-7222|PWY-7205|PWY-7224|PWY-7197|PWY0-166|PWY-7227|PPGPPMET-PWY|PWY-7226|PWY-7221|PWY-6545|PWY-7187}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58759 58759]
+
−
* METABOLIGHTS : MTBLC58759
+
−
{{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K}}
+
−
{{#set: common name=D-gluconate 6-phosphate}}
+
−
{{#set: molecular weight=273.113   }}
+
−
{{#set: common name=6-p gluconate|6-phospho gluconate|6-phosphogluconic acid|6-phospho D-gluconate}}
+
−
{{#set: consumed by=RXN-9952|6PGLUCONDEHYDROG-RXN}}
+
−
{{#set: produced by=6PGLUCONOLACT-RXN}}
+

Latest revision as of 19:47, 21 March 2018

Gene Tiso_gene_16529

  • right end position:
    • 1809
  • transcription direction:
    • POSITIVE
  • left end position:
    • 586
  • centisome position:
    • 13.631077
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16529&oldid=43789"