Difference between revisions of "PWY-6416"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * c...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6416 PWY-6416] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6416 PWY-6416] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
* common name: | * common name: | ||
| − | ** | + | ** quinate degradation II |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| − | + | ** 5 associated gene(s): | |
| − | * [[ | + | *** [[Tiso_gene_14718]] |
| − | == Reaction(s) | + | *** [[Tiso_gene_5752]] |
| + | *** [[Tiso_gene_5753]] | ||
| + | *** [[Tiso_gene_5619]] | ||
| + | *** [[Tiso_gene_8720]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[QUINATE-5-DEHYDROGENASE-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=DHSHIKIMATE-DEHYDRO-RXN DHSHIKIMATE-DEHYDRO-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1239}} | |
| − | + | {{#set: taxonomic range=TAX-201174}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=quinate degradation II}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:47, 21 March 2018
Pathway PWY-6416
- taxonomic range:
- common name:
- quinate degradation II
- Synonym(s):
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- 3-DEHYDROQUINATE-DEHYDRATASE-RXN
- 5 associated gene(s):
- 4 reconstruction source(s) associated:
- QUINATE-5-DEHYDROGENASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
