Difference between revisions of "PWY-5468"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * common name:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5468 PWY-5468] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5468 PWY-5468] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] |
* common name: | * common name: | ||
| − | ** | + | ** lupanine biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[ | + | * [[LYSDECARBOX-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_10395]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8688 RXN-8688] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8692 RXN-8692] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8693 RXN-8693] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8694 RXN-8694] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3803}} | |
| − | + | {{#set: common name=lupanine biosynthesis}} | |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: common name= | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=20.0}} |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:47, 21 March 2018
Pathway PWY-5468
- taxonomic range:
- common name:
- lupanine biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- LYSDECARBOX-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
