Difference between revisions of "CPDQT-38"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribonucleoside-Monophosphates Ribonucleoside-Monophosphates] == * common name: ** a ribonucleos...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(5'-met...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == |
+ | * smiles: | ||
+ | ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** 3-(5'-methylthio)pentylmalate |
+ | * inchi key: | ||
+ | ** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L | ||
+ | * molecular weight: | ||
+ | ** 248.293 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-(5'-methylthio)pentylmalic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXNQT-4171]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-18204]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178] |
− | {{#set: consumed by= | + | {{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=3-(5'-methylthio)pentylmalate}} |
+ | {{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}} | ||
+ | {{#set: molecular weight=248.293 }} | ||
+ | {{#set: common name=3-(5'-methylthio)pentylmalic acid}} | ||
+ | {{#set: consumed by=RXNQT-4171}} | ||
+ | {{#set: reversible reaction associated=RXN-18204}} |
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite CPDQT-38
- smiles:
- CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-(5'-methylthio)pentylmalate
- inchi key:
- InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
- molecular weight:
- 248.293
- Synonym(s):
- 3-(5'-methylthio)pentylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.