Difference between revisions of "PWY-5754"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * smiles: ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O * inchi key: ** InChIK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-hydroxybenzoate biosynthesis I (eukaryotes) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** p-hydroxybenzoate biosynthesis I (eukaryotes) |
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''6''' reactions in the full pathway | |
− | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
− | * [[RXN- | + | *** [[Tiso_gene_12275]] |
− | == Reaction(s) | + | *** [[Tiso_gene_14183]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[TYROSINE-AMINOTRANSFERASE-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_10680]] | ||
+ | *** [[Tiso_gene_6815]] | ||
+ | *** [[Tiso_gene_17718]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.23-RXN 3.1.2.23-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1118 RXN3O-1118] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1120 RXN3O-1120] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=4-hydroxybenzoate biosynthesis I (eukaryotes)}} | |
− | + | {{#set: common name=p-hydroxybenzoate biosynthesis I (eukaryotes)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:48, 21 March 2018
Pathway PWY-5754
- taxonomic range:
- common name:
- 4-hydroxybenzoate biosynthesis I (eukaryotes)
- Synonym(s):
- p-hydroxybenzoate biosynthesis I (eukaryotes)
Reaction(s) found
2 reactions found over 6 reactions in the full pathway
- 4-COUMARATE--COA-LIGASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- TYROSINE-AMINOTRANSFERASE-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated: