Difference between revisions of "Negatively-super-coiled-DNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=YB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Negatively-super-coiled-DNAs Negatively-super-coiled-DNAs] == * common name: ** a negatively su...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Negatively-super-coiled-DNAs Negatively-super-coiled-DNAs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a negatively supercoiled DNA |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[5.99.1.3-RXN]] |
| + | * [[5.99.1.2-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a negatively supercoiled DNA}} | |
| − | + | {{#set: reversible reaction associated=5.99.1.3-RXN|5.99.1.2-RXN}} | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite Negatively-super-coiled-DNAs
- common name:
- a negatively supercoiled DNA
- Synonym(s):
