Difference between revisions of "CPD-7280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_18994 == * left end position: ** 1124 * transcription direction: ** POSITIVE * right end position: ** 1250 * centisome position: ** 42.1131...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * co...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_18994 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] ==
* left end position:
+
* smiles:
** 1124
+
** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O
* transcription direction:
+
* common name:
** POSITIVE
+
** (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
* right end position:
+
* inchi key:
** 1250
+
** InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N
* centisome position:
+
* molecular weight:
** 42.11315    
+
** 382.542    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-11696]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-7974]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1124}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246021 25246021]
{{#set: right end position=1250}}
+
{{#set: smiles=CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O}}
{{#set: centisome position=42.11315   }}
+
{{#set: common name=(3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}}
{{#set: reaction associated=RXN-11696}}
+
{{#set: inchi key=InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N}}
 +
{{#set: molecular weight=382.542   }}
 +
{{#set: produced by=RXN-7974}}

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-7280

  • smiles:
    • CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O
  • common name:
    • (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
  • inchi key:
    • InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N
  • molecular weight:
    • 382.542
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links