Difference between revisions of "CPD-7279"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] == * smiles: ** CC(=O)NC1(C(CC(C([O-])=O)(O)O[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * smiles: ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O * common name: ** 2-ci...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == |
* smiles: | * smiles: | ||
− | ** CC(= | + | ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-cis,4-trans-xanthoxin |
+ | * inchi key: | ||
+ | ** InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 250.337 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** xanthoxin |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7973]] |
+ | * [[RXN-7974]] | ||
+ | * [[RXN-698]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820570 91820570] |
− | * | + | * CHEMSPIDER: |
− | {{#set: smiles=CC(= | + | ** [http://www.chemspider.com/Chemical-Structure.4445403.html 4445403] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32304 32304] |
− | {{#set: molecular weight= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13453 C13453] |
− | {{#set: produced by=RXN- | + | {{#set: smiles=CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O}} |
+ | {{#set: common name=2-cis,4-trans-xanthoxin}} | ||
+ | {{#set: inchi key=InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N}} | ||
+ | {{#set: molecular weight=250.337 }} | ||
+ | {{#set: common name=xanthoxin}} | ||
+ | {{#set: produced by=RXN-7973|RXN-7974|RXN-698}} |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite CPD-7279
- smiles:
- CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O
- common name:
- 2-cis,4-trans-xanthoxin
- inchi key:
- InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N
- molecular weight:
- 250.337
- Synonym(s):
- xanthoxin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links