Difference between revisions of "CPD-7279"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN] == * direction: ** REVERSI...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * smiles: ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O * common name: ** 2-ci...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.2.1.28 EC-1.2.1.28]
+
** 2-cis,4-trans-xanthoxin
 +
* inchi key:
 +
** InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N
 +
* molecular weight:
 +
** 250.337   
 
* Synonym(s):
 
* Synonym(s):
 +
** xanthoxin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[BENZALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[BENZOATE]][c]
+
* [[RXN-7973]]
−
* With common name(s):
+
* [[RXN-7974]]
−
** 1 benzaldehyde[c] '''+''' 1 H2O[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 2 H+[c] '''+''' 1 benzoate[c]
+
* [[RXN-698]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6763]], salicortin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6763 PWY-6763]
+
−
** '''1''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-1501]], mandelate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1501 PWY-1501]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6766]], salicin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6766 PWY-6766]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
* [[TOLUENE-DEG-CATECHOL-PWY]], toluene degradation to benzoate: [http://metacyc.org/META/NEW-IMAGE?object=TOLUENE-DEG-CATECHOL-PWY TOLUENE-DEG-CATECHOL-PWY]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6446]], benzoate biosynthesis III (CoA-dependent, non-&beta;-oxidative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6446 PWY-6446]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6444]], benzoate biosynthesis II (CoA-independent, non-&beta;-oxidative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6444 PWY-6444]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01419 R01419]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820570 91820570]
−
* UNIPROT:
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/P43503 P43503]
+
** [http://www.chemspider.com/Chemical-Structure.4445403.html 4445403]
−
{{#set: direction=REVERSIBLE}}
+
* CHEBI:
−
{{#set: ec number=EC-1.2.1.28}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32304 32304]
−
{{#set: in pathway=PWY-6763|PWY-1501|PWY-6766|TOLUENE-DEG-CATECHOL-PWY|PWY-6446|PWY-6444}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C13453 C13453]
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: smiles=CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=2-cis,4-trans-xanthoxin}}
 +
{{#set: inchi key=InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N}}
 +
{{#set: molecular weight=250.337    }}
 +
{{#set: common name=xanthoxin}}
 +
{{#set: produced by=RXN-7973|RXN-7974|RXN-698}}

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-7279

  • smiles:
    • CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O
  • common name:
    • 2-cis,4-trans-xanthoxin
  • inchi key:
    • InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N
  • molecular weight:
    • 250.337
  • Synonym(s):
    • xanthoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7279&oldid=43865"