Difference between revisions of "RXN-8770"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * smiles: ** C2(=O)(C1(=C(NCC=N1)NC(=O)N2)) * inchi key: ** InChIKey=MY...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8770 RXN-8770] == * direction: ** LEFT-TO-RIGHT * common name: ** plastid_phosphoglycerate_muta...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8770 RXN-8770] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** plastid_phosphoglycerate_mutase_protein |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.73 EC-3.1.3.73] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[ADENOSYLCOBALAMIN-5-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADENOSYLCOBALAMIN]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 adenosylcobalamin 5'-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 adenosylcobalamin[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_16271]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[COBALSYN-PWY]], adenosylcobalamin salvage from cobinamide I: [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] | ||
| + | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
| + | * [[PWY-6269]], adenosylcobalamin salvage from cobinamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] | ||
| + | ** '''2''' reactions found over '''7''' reactions in the full pathway | ||
| + | * [[PWY-5509]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509] | ||
| + | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30370 30370] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=plastid_phosphoglycerate_mutase_protein}} |
| − | {{#set: | + | {{#set: ec number=EC-3.1.3.73}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_16271}} |
| − | {{#set: | + | {{#set: in pathway=COBALSYN-PWY|PWY-6269|PWY-5509}} |
| + | {{#set: reconstruction category=annotation}} | ||
| + | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Latest revision as of 19:48, 21 March 2018
Contents
Reaction RXN-8770
- direction:
- LEFT-TO-RIGHT
- common name:
- plastid_phosphoglycerate_mutase_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ADENOSYLCOBALAMIN-5-P[c] + 1 WATER[c] => 1 Pi[c] + 1 ADENOSYLCOBALAMIN[c]
- With common name(s):
- 1 adenosylcobalamin 5'-phosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 adenosylcobalamin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16271
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- COBALSYN-PWY, adenosylcobalamin salvage from cobinamide I: COBALSYN-PWY
- 2 reactions found over 6 reactions in the full pathway
- PWY-6269, adenosylcobalamin salvage from cobinamide II: PWY-6269
- 2 reactions found over 7 reactions in the full pathway
- PWY-5509, adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I: PWY-5509
- 2 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
