Difference between revisions of "ARABCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARABCAT-PWY ARABCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARABCAT-PWY ARABCAT-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** L- | + | ** L-arabinose degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** L- | + | ** L-arabinose catabolism |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN0-5116]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_16670]] |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| − | = | + | *** [[annotation-in-silico_annotation]] |
| − | * [ | + | == Reaction(s) not found == |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ARABISOM-RXN ARABISOM-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RIBULPEPIM-RXN RIBULPEPIM-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ARABCAT-PWY ARABCAT-PWY] | |
| − | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
| − | + | {{#set: common name=L-arabinose degradation I}} | |
| − | + | {{#set: common name=L-arabinose catabolism}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name=L- | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:49, 21 March 2018
Pathway ARABCAT-PWY
- taxonomic range:
- common name:
- L-arabinose degradation I
- Synonym(s):
- L-arabinose catabolism
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN0-5116
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
