Difference between revisions of "Tiso gene 17030"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * smiles: ** C(=O)(N)CCC([N+])C([O-])=O * inchi key: ** InChIKey=ZDXPYRJPNDTMRX-VKH...") |
(Created page with "Category:Gene == Gene Tiso_gene_17030 == * right end position: ** 1970 * transcription direction: ** POSITIVE * left end position: ** 408 * centisome position: ** 10.29003...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17030 == |
− | * | + | * right end position: |
− | ** | + | ** 1970 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 408 |
− | * | + | * centisome position: |
− | ** | + | ** 10.290038 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-15556]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-7511]] | |
− | + | ||
− | + | ||
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | * | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1970}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=408}} | |
− | + | {{#set: centisome position=10.290038 }} | |
− | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:49, 21 March 2018
Gene Tiso_gene_17030
- right end position:
- 1970
- transcription direction:
- POSITIVE
- left end position:
- 408
- centisome position:
- 10.290038
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation