Difference between revisions of "PWY-5367"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5367 PWY-5367] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5367 PWY-5367] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** petroselinate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** petroselinic acid biosynthesis |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''3''' reactions found over '''6''' reactions in the full pathway |
| − | + | * [[RXN-8391]] | |
| − | * [[RXN- | + | ** 3 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_19302]] |
| + | *** [[Tiso_gene_19303]] | ||
| + | *** [[Tiso_gene_14485]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | * [[RXN-9552]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_9885]] | ||
| + | *** [[Tiso_gene_13083]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-9553]] | ||
| + | ** 0 associated gene: | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8390 RXN-8390] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9551 RXN-9551] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9554 RXN-9554] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3398}} | |
| − | + | {{#set: common name=petroselinate biosynthesis}} | |
| − | {{#set: | + | {{#set: common name=petroselinic acid biosynthesis}} |
| − | {{#set: | + | {{#set: reaction found=3}} |
| − | {{#set: common name= | + | {{#set: total reaction=6}} |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:49, 21 March 2018
Pathway PWY-5367
- taxonomic range:
- common name:
- petroselinate biosynthesis
- Synonym(s):
- petroselinic acid biosynthesis
Reaction(s) found
3 reactions found over 6 reactions in the full pathway
- RXN-8391
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-9552
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-9553
- 0 associated gene:
- 2 reconstruction source(s) associated:
