Difference between revisions of "5-10-METHENYL-THF-GLU-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF-GLU-N 5-10-METHENYL-THF-GLU-N] == * common name: ** a 5,10-methenyltetrahydro...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF-GLU-N 5-10-METHENYL-THF-GLU-N] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 5,10-methenyltetrahydrofolate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a 5,10-methenyl-THF |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-6321]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-576]] |
+ | * [[RXN66-577]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[METHENYLTHFCYCLOHYDRO-RXN]] | ||
+ | * [[METHYLENETHFDEHYDROG-NADP-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a 5,10-methenyltetrahydrofolate}} | |
− | + | {{#set: common name=a 5,10-methenyl-THF}} | |
− | + | {{#set: consumed by=RXN-6321}} | |
− | + | {{#set: produced by=RXN66-576|RXN66-577}} | |
− | {{#set: | + | {{#set: reversible reaction associated=METHENYLTHFCYCLOHYDRO-RXN|METHYLENETHFDEHYDROG-NADP-RXN}} |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite 5-10-METHENYL-THF-GLU-N
- common name:
- a 5,10-methenyltetrahydrofolate
- Synonym(s):
- a 5,10-methenyl-THF