Difference between revisions of "PWY-7237"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-13-BISPHOSPHATE D-MYO-INOSITOL-13-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP([...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7237 PWY-7237] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-13-BISPHOSPHATE D-MYO-INOSITOL-13-BISPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7237 PWY-7237] ==
* smiles:
+
* taxonomic range:
** C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J
+
 
* common name:
 
* common name:
** D-myo-inositol (1,3)-bisphosphate
+
** myo-, chiro- and scillo-inositol degradation
* molecular weight:
+
** 336.085   
+
 
* Synonym(s):
 
* Synonym(s):
** 1D-myo-inositol (1,3)-bisphosphate
 
** myo-inositol (1,3)-bisphosphate
 
** inositol (1,3)-bisphosphate
 
** Ins(1,3)P2
 
** I(1,3)P2
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''6''' reactions in the full pathway
* [[RXN-10959]]
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_17306]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[P562-PWY]]
 +
** 0 associated gene:
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13779 RXN-13779]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14148 RXN-14148]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14178 RXN-14178]
 
== External links  ==
 
== External links  ==
* CAS : 103597-56-4
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=myo-, chiro- and scillo-inositol degradation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201139 25201139]
+
{{#set: reaction found=2}}
* CHEBI:
+
{{#set: total reaction=6}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83242 83242]
+
{{#set: completion rate=33.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04062 C04062]
+
* HMDB : HMDB06234
+
{{#set: smiles=C1(O)(C(O)C(OP([O-])([O-])=O)C(O)C(OP(=O)([O-])[O-])C(O)1)}}
+
{{#set: inchi key=InChIKey=PUVHMWJJTITUGO-FICORBCRSA-J}}
+
{{#set: common name=D-myo-inositol (1,3)-bisphosphate}}
+
{{#set: molecular weight=336.085    }}
+
{{#set: common name=1D-myo-inositol (1,3)-bisphosphate|myo-inositol (1,3)-bisphosphate|inositol (1,3)-bisphosphate|Ins(1,3)P2|I(1,3)P2}}
+
{{#set: produced by=RXN-10959}}
+

Latest revision as of 19:49, 21 March 2018

Pathway PWY-7237

  • taxonomic range:
  • common name:
    • myo-, chiro- and scillo-inositol degradation
  • Synonym(s):

Reaction(s) found

2 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links