Difference between revisions of "CPD-10277"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5176 == * left end position: ** 631 * transcription direction: ** POSITIVE * right end position: ** 2201 * centisome position: ** 4.567499...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * common name: ** lota...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == |
− | * | + | * smiles: |
− | ** | + | ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C |
− | * | + | * common name: |
− | ** | + | ** lotaustralin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 261.274 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9674]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-13603]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467] |
− | {{#set: | + | * HMDB : HMDB33865 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334] | ||
+ | {{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}} | ||
+ | {{#set: common name=lotaustralin}} | ||
+ | {{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}} | ||
+ | {{#set: molecular weight=261.274 }} | ||
+ | {{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}} | ||
+ | {{#set: consumed by=RXN-9674}} | ||
+ | {{#set: produced by=RXN-13603}} |
Latest revision as of 20:49, 21 March 2018
Contents
Metabolite CPD-10277
- smiles:
- CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
- common name:
- lotaustralin
- inchi key:
- InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
- molecular weight:
- 261.274
- Synonym(s):
- 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links