Difference between revisions of "CPD-10277"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5176 == * left end position: ** 631 * transcription direction: ** POSITIVE * right end position: ** 2201 * centisome position: ** 4.567499...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * common name: ** lota...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5176 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
−
* left end position:
+
* smiles:
−
** 631
+
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** lotaustralin
−
* right end position:
+
* inchi key:
−
** 2201
+
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
−
* centisome position:
+
* molecular weight:
−
** 4.567499    
+
** 261.274    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[RXN-9674]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-13603]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=631}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
−
{{#set: right end position=2201}}
+
* HMDB : HMDB33865
−
{{#set: centisome position=4.567499   }}
+
* CHEBI:
−
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
 +
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
 +
{{#set: common name=lotaustralin}}
 +
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
 +
{{#set: molecular weight=261.274   }}
 +
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
 +
{{#set: consumed by=RXN-9674}}
 +
{{#set: produced by=RXN-13603}}

Latest revision as of 19:49, 21 March 2018

Metabolite CPD-10277

  • smiles:
    • CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
  • common name:
    • lotaustralin
  • inchi key:
    • InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
  • molecular weight:
    • 261.274
  • Synonym(s):
    • 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-10277&oldid=43997"