Difference between revisions of "4.2.1.61-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.61-RXN 4.2.1.61-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.61-RXN 4.2.1.61-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** polyketide_synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86] |
+ | ** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85] | ||
+ | ** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** D-3-hydroxypalmitoyl-[acyl-carrier-protein] dehydratase |
− | ** | + | ** β-hydroxypalmitoyl-acyl carrier protein dehydrase |
− | ** | + | ** β-hydroxypalmitoyl thioester dehydratase |
+ | ** β-hydroxypalmityl-ACP dehydrase | ||
+ | ** (3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase | ||
+ | ** (3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase (hexadec-2-enoyl-[acyl-carrier protein]-forming) | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[R-3-Hydroxypalmitoyl-ACPs]][c] '''=>''' 1 [[2-Hexadecenoyl-ACPs]][c] '''+''' 1 [[WATER]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 a (3R)-3-hydroxypalmitoyl-[acp][c] '''=>''' 1 a trans hexadecenoyl-[acp][c] '''+''' 1 H2O[c] |
− | == | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Tiso_gene_136]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_13394]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_6884]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_135]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_500]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_10876]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971] | ||
+ | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
+ | * [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] | ||
+ | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04462 R04462] | |
− | ** [http:// | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P49327 P49327] |
− | * | + | ** [http://www.uniprot.org/uniprot/P07149 P07149] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P12276 P12276] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12785 P12785] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=polyketide_synthase}} | |
− | {{#set: | + | {{#set: ec number=EC-2.3.1.86}} |
− | {{#set: | + | {{#set: ec number=EC-2.3.1.85}} |
− | {{#set: | + | {{#set: ec number=EC-4.2.1.59}} |
− | {{#set: | + | {{#set: common name=D-3-hydroxypalmitoyl-[acyl-carrier-protein] dehydratase|β-hydroxypalmitoyl-acyl carrier protein dehydrase|β-hydroxypalmitoyl thioester dehydratase|β-hydroxypalmityl-ACP dehydrase|(3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase|(3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase (hexadec-2-enoyl-[acyl-carrier protein]-forming)}} |
− | {{#set: common name= | + | {{#set: gene associated=Tiso_gene_136|Tiso_gene_13394|Tiso_gene_6884|Tiso_gene_135|Tiso_gene_500|Tiso_gene_10876}} |
− | {{#set: | + | {{#set: in pathway=PWY-5971|PWY-5994}} |
− | {{#set: | + | {{#set: reconstruction category=manual|annotation}} |
+ | {{#set: reconstruction source=annotation-experimental_annotation|manual-primary_network|annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:49, 21 March 2018
Contents
Reaction 4.2.1.61-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- polyketide_synthase
- ec number:
- Synonym(s):
- D-3-hydroxypalmitoyl-[acyl-carrier-protein] dehydratase
- β-hydroxypalmitoyl-acyl carrier protein dehydrase
- β-hydroxypalmitoyl thioester dehydratase
- β-hydroxypalmityl-ACP dehydrase
- (3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase
- (3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase (hexadec-2-enoyl-[acyl-carrier protein]-forming)
Reaction Formula
- With identifiers:
- 1 R-3-Hydroxypalmitoyl-ACPs[c] => 1 2-Hexadecenoyl-ACPs[c] + 1 WATER[c]
- With common name(s):
- 1 a (3R)-3-hydroxypalmitoyl-[acp][c] => 1 a trans hexadecenoyl-[acp][c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_136
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13394
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6884
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_135
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_500
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10876
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
- 31 reactions found over 31 reactions in the full pathway
- PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
- 31 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- "D-3-hydroxypalmitoyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.
- "(3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase" cannot be used as a page name in this wiki.
- "(3R)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase (hexadec-2-enoyl-[acyl-carrier protein]-forming)" cannot be used as a page name in this wiki.