Difference between revisions of "RXN0-5063"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5063 RXN0-5063] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5063 RXN0-5063] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
* common name:
+
* ec number:
** trans-caffeoyl-CoA
+
** [http://enzyme.expasy.org/EC/2.8.4.3 EC-2.8.4.3]
* inchi key:
+
** InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J
+
* molecular weight:
+
** 925.647   
+
 
* Synonym(s):
 
* Synonym(s):
** 3,4-dihydroxyacryloyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[6-Dimethylallyladenosine37-tRNAs]][c] '''+''' 1 [[Sulfurated-Sulfur-Acceptors]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[CPD-11592]][c]
* [[RXN-1126]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 a sulfurated [sulfur carrier][c] '''+''' 2 S-adenosyl-L-methionine[c] '''+''' 1 a reduced electron acceptor[c] '''=>''' 1 an unsulfurated [sulfur carrier][c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 L-methionine[c] '''+''' 1 5'-deoxyadenosine[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 2 H+[c] '''+''' 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12431]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266599 45266599]
+
{{#set: ec number=EC-2.8.4.3}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_12431}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57372 57372]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C00323 C00323]
+
{{#set: reconstruction source=orthology-esiliculosus}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=trans-caffeoyl-CoA}}
+
{{#set: inchi key=InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J}}
+
{{#set: molecular weight=925.647    }}
+
{{#set: common name=3,4-dihydroxyacryloyl-CoA}}
+
{{#set: consumed by=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}}
+
{{#set: produced by=RXN-1126}}
+

Latest revision as of 19:49, 21 March 2018

Reaction RXN0-5063

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links