Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7153 PWY-7153] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1760 TAX-17...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7153 PWY-7153] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1760 TAX-1760]
+
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
 
* common name:
 
* common name:
** grixazone biosynthesis
+
** α,ω-9Z-octadecenedioate
 +
* inchi key:
 +
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
 +
* molecular weight:
 +
** 310.433   
 
* Synonym(s):
 
* Synonym(s):
 +
** α,ω-9Z-octadecenedioic acid
 +
** 1,18-9Z-octadecenedioic acid
 +
** octadecenedioate
 +
** 18-carboxyl oleate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
* [[RXN-16418]]
** [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[ASPARTATEKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* '''6''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13865 RXN-13865]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13866 RXN-13866]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13867 RXN-13867]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13868 RXN-13868]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13869 RXN-13869]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-15414 RXN-15414]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-1760}}
+
* PUBCHEM:
{{#set: common name=grixazone biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
{{#set: reaction found=2}}
+
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
{{#set: reaction not found=6}}
+
{{#set: common name=α,ω-9Z-octadecenedioate}}
 +
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
 +
{{#set: molecular weight=310.433    }}
 +
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
 +
{{#set: consumed by=RXN-16418}}

Latest revision as of 20:50, 21 March 2018

Metabolite OCTADEC-9-ENE-118-DIOIC-ACID

  • smiles:
    • C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
  • common name:
    • α,ω-9Z-octadecenedioate
  • inchi key:
    • InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
  • molecular weight:
    • 310.433
  • Synonym(s):
    • α,ω-9Z-octadecenedioic acid
    • 1,18-9Z-octadecenedioic acid
    • octadecenedioate
    • 18-carboxyl oleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.