Difference between revisions of "POLYAMINSYN3-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * smiles: ** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=POLYAMINSYN3-PWY POLYAMINSYN3-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=POLYAMINSYN3-PWY POLYAMINSYN3-PWY] ==
* smiles:
+
* taxonomic range:
** CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J
+
 
* common name:
 
* common name:
** (11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA
+
** superpathway of polyamine biosynthesis II
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** polyamn
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16559]]
+
'''3''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[BSUBPOLYAMSYN-PWY]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[PWY-46]]
 +
** 0 associated gene:
 +
* [[SPERMINE-SYNTHASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_17081]]
 +
*** [[Tiso_gene_17803]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-43 PWY-43]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-43 PWY-43]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820456 91820456]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=POLYAMINSYN3-PWY POLYAMINSYN3-PWY]
{{#set: smiles=CCCCC=CCCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: taxonomic range=TAX-2759}}
{{#set: inchi key=InChIKey=SHGDVNGLFXVIAK-BFVORPHASA-J}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=(11Z)-(S)-3-hydroxyhexadec-11-enoyl-CoA}}
+
{{#set: common name=superpathway of polyamine biosynthesis II}}
{{#set: molecular weight=1015.898    }}
+
{{#set: common name=polyamn}}
{{#set: consumed by=RXN-16559}}
+
{{#set: reaction found=3}}
 +
{{#set: total reaction=7}}
 +
{{#set: completion rate=43.0}}

Latest revision as of 19:50, 21 March 2018

Pathway POLYAMINSYN3-PWY

  • taxonomic range:
  • common name:
    • superpathway of polyamine biosynthesis II
  • Synonym(s):
    • polyamn

Reaction(s) found

3 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links