Difference between revisions of "Protein-Ox-Disulfides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Ox-Disulfides Protein-Ox-Disulfides] == * common name: ** a protein with oxidized disul...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Ox-Disulfides Protein-Ox-Disulfides] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a protein with oxidized disulfide bonds |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a protein with oxidized disulfide bonds | ||
+ | ** protein with oxidized disulfide bonds | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[DISULFOXRED-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a protein with oxidized disulfide bonds}} | |
− | + | {{#set: common name=a protein with oxidized disulfide bonds|protein with oxidized disulfide bonds}} | |
− | + | {{#set: reversible reaction associated=DISULFOXRED-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite Protein-Ox-Disulfides
- common name:
- a protein with oxidized disulfide bonds
- Synonym(s):
- a protein with oxidized disulfide bonds
- protein with oxidized disulfide bonds